C21H28N4O3S — CID 10573958
ethyl 2-[4-[[4-[4-(C-ethoxycarbonimidoyl)phenyl]-1,3-thiazol-2-yl]amino]piperidin-1-yl]acetate (PubChem CID 10573958) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is ethyl 2-[4-[[4-[4-(C-ethoxycarbonimidoyl)phenyl]-1,3-thiazol-2-yl]amino]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[4-[4-(C-ethoxycarbonimidoyl)phenyl]-1,3-thiazol-2-yl]amino]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 10573958 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | ethyl 2-[4-[[4-[4-(C-ethoxycarbonimidoyl)phenyl]-1,3-thiazol-2-yl]amino]piperidin-1-yl]acetate |
| SMILES | [H]/N=C(\OCC)c1ccc(-c2csc(NC3CCN(CC(=O)OCC)CC3)n2)cc1 |
| InChI | InChI=1S/C21H28N4O3S/c1-3-27-19(26)13-25-11-9-17(10-12-25)23-21-24-18(14-29-21)15-5-7-16(8-6-15)20(22)28-4-2/h5-8,14,17,22H,3-4,9-13H2,1-2H3,(H,23,24)/b22-20- |
| InChIKey | OAQVAWZTRZXOMG-XDOYNYLZSA-N |
| XLogP | 3.61 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|