C22H29N5O5S — CID 85060902
3-[[1-(2-ethoxy-2-oxoethyl)piperidin-4-yl]-[4-[4-(N'-hydroxycarbamimidoyl)phenyl]-1,3-thiazol-2-yl]amino]propanoic acid (PubChem CID 85060902) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is 3-[[1-(2-ethoxy-2-oxoethyl)piperidin-4-yl]-[4-[4-(N'-hydroxycarbamimidoyl)phenyl]-1,3-thiazol-2-yl]amino]propanoic acid.
| Compound Name | 3-[[1-(2-ethoxy-2-oxoethyl)piperidin-4-yl]-[4-[4-(N'-hydroxycarbamimidoyl)phenyl]-1,3-thiazol-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 85060902 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 3-[[1-(2-ethoxy-2-oxoethyl)piperidin-4-yl]-[4-[4-(N'-hydroxycarbamimidoyl)phenyl]-1,3-thiazol-2-yl]amino]propanoic acid |
| SMILES | CCOC(=O)CN1CCC(N(CCC(=O)O)c2nc(-c3ccc(C(N)=NO)cc3)cs2)CC1 |
| InChI | InChI=1S/C22H29N5O5S/c1-2-32-20(30)13-26-10-7-17(8-11-26)27(12-9-19(28)29)22-24-18(14-33-22)15-3-5-16(6-4-15)21(23)25-31/h3-6,14,17,31H,2,7-13H2,1H3,(H2,23,25)(H,28,29) |
| InChIKey | LQFBMUGJCOVOQO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|