C29H23NO2 — CID 10573995
(5S,6R)-3-benzhydryl-6-phenyl-3-azatricyclo[5.2.2.01,5]undeca-8,10-diene-2,4-dione (PubChem CID 10573995) has the molecular formula C29H23NO2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (5S,6R)-3-benzhydryl-6-phenyl-3-azatricyclo[5.2.2.01,5]undeca-8,10-diene-2,4-dione.
| Compound Name | (5S,6R)-3-benzhydryl-6-phenyl-3-azatricyclo[5.2.2.01,5]undeca-8,10-diene-2,4-dione |
|---|---|
| PubChem CID | 10573995 |
| Molecular Formula | C29H23NO2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (5S,6R)-3-benzhydryl-6-phenyl-3-azatricyclo[5.2.2.01,5]undeca-8,10-diene-2,4-dione |
| SMILES | O=C1[C@H]2[C@H](c3ccccc3)C3C=CC2(C=C3)C(=O)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23NO2/c31-27-25-24(20-10-4-1-5-11-20)21-16-18-29(25,19-17-21)28(32)30(27)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19,21,24-26H/t21?,24-,25-,29?/m1/s1 |
| InChIKey | KTWHCWQBZMSEGB-ASASSYCRSA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|