C27H52O6Si — CID 10577338
methyl (2R)-3-[(2S,3R,5S,6S,9R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 10577338) has the molecular formula C27H52O6Si and a molecular weight of 500.79 g/mol. Its IUPAC name is methyl (2R)-3-[(2S,3R,5S,6S,9R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | methyl (2R)-3-[(2S,3R,5S,6S,9R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 10577338 |
| Molecular Formula | C27H52O6Si |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | methyl (2R)-3-[(2S,3R,5S,6S,9R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | COC(=O)[C@@H](C[C@@H]1O[C@@]2(C[C@H](C)CC[C@H]2C(C)C)O[C@@H]1CO[Si](C)(C)C(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C27H52O6Si/c1-18(2)20-14-13-19(3)16-27(20)32-21(15-22(24(28)29-10)31-25(4,5)6)23(33-27)17-30-34(11,12)26(7,8)9/h18-23H,13-17H2,1-12H3/t19-,20+,21+,22-,23-,27+/m1/s1 |
| InChIKey | DCKHXOHJFSNYJL-VZPBSDDSSA-N |
| XLogP | 6.33 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|