C24H42O6Si — CID 101425660
(3aS,5R,8R,9S,10R,10aR)-9-[tert-butyl(dimethyl)silyl]oxy-3a,5,8,10-tetramethylspiro[8,9,10,10a-tetrahydro-[1,3]dioxolo[4,5-e]oxonine-2,1'-cyclohexane]-4,6-dione (PubChem CID 101425660) has the molecular formula C24H42O6Si and a molecular weight of 454.68 g/mol. Its IUPAC name is (3aS,5R,8R,9S,10R,10aR)-9-[tert-butyl(dimethyl)silyl]oxy-3a,5,8,10-tetramethylspiro[8,9,10,10a-tetrahydro-[1,3]dioxolo[4,5-e]oxonine-2,1'-cyclohexane]-4,6-dione.
| Compound Name | (3aS,5R,8R,9S,10R,10aR)-9-[tert-butyl(dimethyl)silyl]oxy-3a,5,8,10-tetramethylspiro[8,9,10,10a-tetrahydro-[1,3]dioxolo[4,5-e]oxonine-2,1'-cyclohexane]-4,6-dione |
|---|---|
| PubChem CID | 101425660 |
| Molecular Formula | C24H42O6Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (3aS,5R,8R,9S,10R,10aR)-9-[tert-butyl(dimethyl)silyl]oxy-3a,5,8,10-tetramethylspiro[8,9,10,10a-tetrahydro-[1,3]dioxolo[4,5-e]oxonine-2,1'-cyclohexane]-4,6-dione |
| SMILES | C[C@H]1C(=O)O[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]2OC3(CCCCC3)O[C@]2(C)C1=O |
| InChI | InChI=1S/C24H42O6Si/c1-15-18(29-31(8,9)22(4,5)6)17(3)27-21(26)16(2)19(25)23(7)20(15)28-24(30-23)13-11-10-12-14-24/h15-18,20H,10-14H2,1-9H3/t15-,16+,17+,18-,20+,23+/m0/s1 |
| InChIKey | POWUHMXHXYXYLC-AXUDRJAESA-N |
| XLogP | 5.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|