C34H40N4O2 — CID 10578286
1-[4-[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]butyl]-4-phenylpiperazine (PubChem CID 10578286) has the molecular formula C34H40N4O2 and a molecular weight of 536.72 g/mol. Its IUPAC name is 1-[4-[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]butyl]-4-phenylpiperazine.
| Compound Name | 1-[4-[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]butyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 10578286 |
| Molecular Formula | C34H40N4O2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 1-[4-[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]butyl]-4-phenylpiperazine |
| SMILES | CC1(CCCCN2CCN(c3ccccc3)CC2)COC(c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)OC1 |
| InChI | InChI=1S/C34H40N4O2/c1-34(19-11-12-20-37-21-23-38(24-22-37)29-17-9-4-10-18-29)25-39-33(40-26-34)32-35-30(27-13-5-2-6-14-27)31(36-32)28-15-7-3-8-16-28/h2-10,13-18,33H,11-12,19-26H2,1H3,(H,35,36) |
| InChIKey | RMZQGAZJVLSOER-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|