C33H28O11 — CID 10579469
1,8-dihydroxy-3-methoxy-6-methyl-2-[(2S,3S)-2,3,10-trihydroxy-5,7-dimethoxy-2-methyl-4-oxo-1,3-dihydroanthracen-9-yl]anthracene-9,10-dione (PubChem CID 10579469) has the molecular formula C33H28O11 and a molecular weight of 600.58 g/mol. Its IUPAC name is 1,8-dihydroxy-3-methoxy-6-methyl-2-[(2S,3S)-2,3,10-trihydroxy-5,7-dimethoxy-2-methyl-4-oxo-1,3-dihydroanthracen-9-yl]anthracene-9,10-dione.
| Compound Name | 1,8-dihydroxy-3-methoxy-6-methyl-2-[(2S,3S)-2,3,10-trihydroxy-5,7-dimethoxy-2-methyl-4-oxo-1,3-dihydroanthracen-9-yl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 10579469 |
| Molecular Formula | C33H28O11 |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | 1,8-dihydroxy-3-methoxy-6-methyl-2-[(2S,3S)-2,3,10-trihydroxy-5,7-dimethoxy-2-methyl-4-oxo-1,3-dihydroanthracen-9-yl]anthracene-9,10-dione |
| SMILES | COc1cc(OC)c2c(O)c3c(c(-c4c(OC)cc5c(c4O)C(=O)c4c(O)cc(C)cc4C5=O)c2c1)C[C@](C)(O)[C@H](O)C3=O |
| InChI | InChI=1S/C33H28O11/c1-12-6-15-22(18(34)7-12)28(36)24-16(27(15)35)10-20(44-5)26(30(24)38)21-14-8-13(42-3)9-19(43-4)23(14)29(37)25-17(21)11-33(2,41)32(40)31(25)39/h6-10,32,34,37-38,40-41H,11H2,1-5H3/t32-,33+/m1/s1 |
| InChIKey | FWOHGTUCKDNPLQ-SAIUNTKASA-N |
| XLogP | 3.58 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|