C31H29N5O6S2 — CID 10579878
benzhydryl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-(4-hydroxybut-1-ynyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate (PubChem CID 10579878) has the molecular formula C31H29N5O6S2 and a molecular weight of 631.74 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-(4-hydroxybut-1-ynyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-(4-hydroxybut-1-ynyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 10579878 |
| Molecular Formula | C31H29N5O6S2 |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | benzhydryl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-(4-hydroxybut-1-ynyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
| SMILES | CCO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)C(C#CCCO)=CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C31H29N5O6S2/c1-2-41-35-23(22-18-44-31(32)33-22)27(38)34-24-28(39)36-25(21(15-9-10-16-37)17-43-29(24)36)30(40)42-26(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-8,11-14,17-18,24-26,29,37H,2,10,16H2,1H3,(H2,32,33)(H,34,38)/b35-23-/t24-,25?,29-/m1/s1 |
| InChIKey | DXRLSDSQNHTQAO-QBRVXYKDSA-N |
| XLogP | 2.84 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|