C15H16O2 — CID 10585447
6-(2,5-dihydrofuran-2-yl)-6-phenyl-2,5-dihydropyran (PubChem CID 10585447) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 6-(2,5-dihydrofuran-2-yl)-6-phenyl-2,5-dihydropyran.
| Compound Name | 6-(2,5-dihydrofuran-2-yl)-6-phenyl-2,5-dihydropyran |
|---|---|
| PubChem CID | 10585447 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 6-(2,5-dihydrofuran-2-yl)-6-phenyl-2,5-dihydropyran |
| SMILES | C1=CC(C2(c3ccccc3)CC=CCO2)OC1 |
| InChI | InChI=1S/C15H16O2/c1-2-7-13(8-3-1)15(10-4-5-12-17-15)14-9-6-11-16-14/h1-9,14H,10-12H2 |
| InChIKey | AWBIHANBZJKXCD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|