C16H26O — CID 10585799
(1S,8S,9R,10S)-8-methyl-10-[(2-methylpropan-2-yl)oxy]tricyclo[6.2.1.03,9]undec-2-ene (PubChem CID 10585799) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (1S,8S,9R,10S)-8-methyl-10-[(2-methylpropan-2-yl)oxy]tricyclo[6.2.1.03,9]undec-2-ene.
| Compound Name | (1S,8S,9R,10S)-8-methyl-10-[(2-methylpropan-2-yl)oxy]tricyclo[6.2.1.03,9]undec-2-ene |
|---|---|
| PubChem CID | 10585799 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (1S,8S,9R,10S)-8-methyl-10-[(2-methylpropan-2-yl)oxy]tricyclo[6.2.1.03,9]undec-2-ene |
| SMILES | CC(C)(C)O[C@H]1[C@@H]2C=C3CCCC[C@@](C)(C2)[C@H]31 |
| InChI | InChI=1S/C16H26O/c1-15(2,3)17-14-12-9-11-7-5-6-8-16(4,10-12)13(11)14/h9,12-14H,5-8,10H2,1-4H3/t12-,13-,14+,16+/m1/s1 |
| InChIKey | JBSKPMYTMMOMDB-NYTXWWLZSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|