C9H6F6O — CID 10586348
(1S,4R)-1-methyl-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 10586348) has the molecular formula C9H6F6O and a molecular weight of 244.13 g/mol. Its IUPAC name is (1S,4R)-1-methyl-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (1S,4R)-1-methyl-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 10586348 |
| Molecular Formula | C9H6F6O |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | (1S,4R)-1-methyl-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | C[C@@]12C=C[C@@H](O1)C(C(F)(F)F)=C2C(F)(F)F |
| InChI | InChI=1S/C9H6F6O/c1-7-3-2-4(16-7)5(8(10,11)12)6(7)9(13,14)15/h2-4H,1H3/t4-,7+/m1/s1 |
| InChIKey | BOPHVNCSUPCSMC-FBCQKBJTSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|