C8H4F6O — CID 10704612
(1S,4R)-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 10704612) has the molecular formula C8H4F6O and a molecular weight of 230.11 g/mol. Its IUPAC name is (1S,4R)-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (1S,4R)-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 10704612 |
| Molecular Formula | C8H4F6O |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | (1S,4R)-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C8H4F6O/c9-7(10,11)5-3-1-2-4(15-3)6(5)8(12,13)14/h1-4H/t3-,4+ |
| InChIKey | MGVLQGGDEXTVKS-ZXZARUISSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|