C8H4F4O — CID 135005108
5,6-bis(difluoromethylidene)-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 135005108) has the molecular formula C8H4F4O and a molecular weight of 192.11 g/mol. Its IUPAC name is 5,6-bis(difluoromethylidene)-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,6-bis(difluoromethylidene)-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 135005108 |
| Molecular Formula | C8H4F4O |
| Molecular Weight | 192.11 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 5,6-bis(difluoromethylidene)-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)=C1C(=C(F)F)C2C=CC1O2 |
| InChI | InChI=1S/C8H4F4O/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12/h1-4H |
| InChIKey | ATOWLXPNTWGSDR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|