C11H15ClNO2P — CID 10587521
(2S)-2-chloro-6,6-dideuterio-3-[(1R)-1-phenylethyl]-1,3,2lambda5-oxazaphosphinane 2-oxide (PubChem CID 10587521) has the molecular formula C11H15ClNO2P and a molecular weight of 261.69 g/mol. Its IUPAC name is (2S)-2-chloro-6,6-dideuterio-3-[(1R)-1-phenylethyl]-1,3,2lambda5-oxazaphosphinane 2-oxide.
| Compound Name | (2S)-2-chloro-6,6-dideuterio-3-[(1R)-1-phenylethyl]-1,3,2lambda5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 10587521 |
| Molecular Formula | C11H15ClNO2P |
| Molecular Weight | 261.69 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2S)-2-chloro-6,6-dideuterio-3-[(1R)-1-phenylethyl]-1,3,2lambda5-oxazaphosphinane 2-oxide |
| SMILES | [2H]C1([2H])CCN([C@H](C)c2ccccc2)[P@@](=O)(Cl)O1 |
| InChI | InChI=1S/C11H15ClNO2P/c1-10(11-6-3-2-4-7-11)13-8-5-9-15-16(13,12)14/h2-4,6-7,10H,5,8-9H2,1H3/t10-,16-/m1/s1/i9D2 |
| InChIKey | RTAHEODDAQYTQU-VTONGWONSA-N |
| XLogP | 3.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|