C16H24NO2P — CID 10565652
(2R)-6,6-dimethyl-3-[(1S)-1-phenylethyl]-2-prop-2-enyl-1,3,2λ5-oxazaphosphinane 2-oxide (PubChem CID 10565652) has the molecular formula C16H24NO2P and a molecular weight of 293.35 g/mol. Its IUPAC name is (2R)-6,6-dimethyl-3-[(1S)-1-phenylethyl]-2-prop-2-enyl-1,3,2λ5-oxazaphosphinane 2-oxide.
| Compound Name | (2R)-6,6-dimethyl-3-[(1S)-1-phenylethyl]-2-prop-2-enyl-1,3,2λ5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 10565652 |
| Molecular Formula | C16H24NO2P |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (2R)-6,6-dimethyl-3-[(1S)-1-phenylethyl]-2-prop-2-enyl-1,3,2λ5-oxazaphosphinane 2-oxide |
| SMILES | C=CC[P@@]1(=O)OC(C)(C)CCN1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H24NO2P/c1-5-13-20(18)17(12-11-16(3,4)19-20)14(2)15-9-7-6-8-10-15/h5-10,14H,1,11-13H2,2-4H3/t14-,20+/m0/s1 |
| InChIKey | NXWLJHMHZRYIRF-VBKZILBWSA-N |
| XLogP | 4.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|