C17H22O3 — CID 10588394
(4'E)-4'-ethylidene-3',3'-dimethoxy-2'-methylspiro[cyclopropane-1,1'-naphthalene]-2'-ol (PubChem CID 10588394) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4'E)-4'-ethylidene-3',3'-dimethoxy-2'-methylspiro[cyclopropane-1,1'-naphthalene]-2'-ol.
| Compound Name | (4'E)-4'-ethylidene-3',3'-dimethoxy-2'-methylspiro[cyclopropane-1,1'-naphthalene]-2'-ol |
|---|---|
| PubChem CID | 10588394 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (4'E)-4'-ethylidene-3',3'-dimethoxy-2'-methylspiro[cyclopropane-1,1'-naphthalene]-2'-ol |
| SMILES | C/C=C1\c2ccccc2C2(CC2)C(C)(O)C1(OC)OC |
| InChI | InChI=1S/C17H22O3/c1-5-13-12-8-6-7-9-14(12)16(10-11-16)15(2,18)17(13,19-3)20-4/h5-9,18H,10-11H2,1-4H3/b13-5+ |
| InChIKey | RSNKWELYOAUIDY-WLRTZDKTSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|