C17H17N5OS — CID 10593180
4-amino-3-[2-(benzhydrylideneamino)oxyethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 10593180) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-amino-3-[2-(benzhydrylideneamino)oxyethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[2-(benzhydrylideneamino)oxyethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 10593180 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-amino-3-[2-(benzhydrylideneamino)oxyethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(CCON=C(c2ccccc2)c2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C17H17N5OS/c18-22-15(19-20-17(22)24)11-12-23-21-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,18H2,(H,20,24) |
| InChIKey | ROCSZLPDAVJUNE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|