C12H17N7O — CID 11022129
3-hydrazinyl-5-[2-[(E)-1-phenylethylideneamino]oxyethyl]-1,2,4-triazol-4-amine (PubChem CID 11022129) has the molecular formula C12H17N7O and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-hydrazinyl-5-[2-[(E)-1-phenylethylideneamino]oxyethyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-hydrazinyl-5-[2-[(E)-1-phenylethylideneamino]oxyethyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 11022129 |
| Molecular Formula | C12H17N7O |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-hydrazinyl-5-[2-[(E)-1-phenylethylideneamino]oxyethyl]-1,2,4-triazol-4-amine |
| SMILES | C/C(=N\OCCc1nnc(NN)n1N)c1ccccc1 |
| InChI | InChI=1S/C12H17N7O/c1-9(10-5-3-2-4-6-10)18-20-8-7-11-16-17-12(15-13)19(11)14/h2-6H,7-8,13-14H2,1H3,(H,15,17)/b18-9+ |
| InChIKey | FFQUEWDPBDBCMW-GIJQJNRQSA-N |
| XLogP | 0.26 |
| TPSA | 116.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|