C21H25NO4 — CID 10594363
(3aS,5R,6S,6aS)-1-benzyl-5-(hydroxymethyl)-5-phenylmethoxy-3a,4,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-6-ol (PubChem CID 10594363) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (3aS,5R,6S,6aS)-1-benzyl-5-(hydroxymethyl)-5-phenylmethoxy-3a,4,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-6-ol.
| Compound Name | (3aS,5R,6S,6aS)-1-benzyl-5-(hydroxymethyl)-5-phenylmethoxy-3a,4,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-6-ol |
|---|---|
| PubChem CID | 10594363 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (3aS,5R,6S,6aS)-1-benzyl-5-(hydroxymethyl)-5-phenylmethoxy-3a,4,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-6-ol |
| SMILES | OC[C@]1(OCc2ccccc2)C[C@@H]2CON(Cc3ccccc3)[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C21H25NO4/c23-15-21(25-13-17-9-5-2-6-10-17)11-18-14-26-22(19(18)20(21)24)12-16-7-3-1-4-8-16/h1-10,18-20,23-24H,11-15H2/t18-,19+,20+,21-/m1/s1 |
| InChIKey | JNZZONXIJURMPY-IVAOSVALSA-N |
| XLogP | 2.13 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |