C35H37NO4 — CID 134833074
(3aS,4S,5S,6S,6aR)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole (PubChem CID 134833074) has the molecular formula C35H37NO4 and a molecular weight of 535.68 g/mol. Its IUPAC name is (3aS,4S,5S,6S,6aR)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole.
| Compound Name | (3aS,4S,5S,6S,6aR)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole |
|---|---|
| PubChem CID | 134833074 |
| Molecular Formula | C35H37NO4 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | (3aS,4S,5S,6S,6aR)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole |
| SMILES | c1ccc(COC[C@@H]2[C@@H]3CON(Cc4ccccc4)[C@H]3[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H37NO4/c1-5-13-27(14-6-1)21-36-33-31(26-40-36)32(25-37-22-28-15-7-2-8-16-28)34(38-23-29-17-9-3-10-18-29)35(33)39-24-30-19-11-4-12-20-30/h1-20,31-35H,21-26H2/t31-,32+,33+,34-,35-/m0/s1 |
| InChIKey | XTQOOQWEQNYSAN-PEINCPOXSA-N |
| XLogP | 6.44 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |