C35H37NO5 — CID 134833203
(3aR,4S,5R,6S,6aR)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol (PubChem CID 134833203) has the molecular formula C35H37NO5 and a molecular weight of 551.68 g/mol. Its IUPAC name is (3aR,4S,5R,6S,6aR)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol.
| Compound Name | (3aR,4S,5R,6S,6aR)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol |
|---|---|
| PubChem CID | 134833203 |
| Molecular Formula | C35H37NO5 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | (3aR,4S,5R,6S,6aR)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol |
| SMILES | O[C@@]1(COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]2[C@@H]1CON2Cc1ccccc1 |
| InChI | InChI=1S/C35H37NO5/c37-35(26-38-22-28-15-7-2-8-16-28)31-25-41-36(21-27-13-5-1-6-14-27)32(31)33(39-23-29-17-9-3-10-18-29)34(35)40-24-30-19-11-4-12-20-30/h1-20,31-34,37H,21-26H2/t31-,32+,33-,34+,35+/m0/s1 |
| InChIKey | BLPRKHZGHFQQLH-IVFJIKSYSA-N |
| XLogP | 5.55 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |