C42H43NO5 — CID 134833202
(3aS,4S,5R,6S,6aS)-1-benzyl-4,5,6-tris(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazole (PubChem CID 134833202) has the molecular formula C42H43NO5 and a molecular weight of 641.81 g/mol. Its IUPAC name is (3aS,4S,5R,6S,6aS)-1-benzyl-4,5,6-tris(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazole.
| Compound Name | (3aS,4S,5R,6S,6aS)-1-benzyl-4,5,6-tris(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazole |
|---|---|
| PubChem CID | 134833202 |
| Molecular Formula | C42H43NO5 |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | (3aS,4S,5R,6S,6aS)-1-benzyl-4,5,6-tris(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazole |
| SMILES | c1ccc(COC[C@@]2(OCc3ccccc3)[C@@H]3CON(Cc4ccccc4)[C@@H]3[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C42H43NO5/c1-6-16-33(17-7-1)26-43-39-38(31-48-43)42(47-30-37-24-14-5-15-25-37,32-44-27-34-18-8-2-9-19-34)41(46-29-36-22-12-4-13-23-36)40(39)45-28-35-20-10-3-11-21-35/h1-25,38-41H,26-32H2/t38-,39+,40+,41-,42-/m1/s1 |
| InChIKey | CPYXNDTVYDPNOP-ZGQNSXDSSA-N |
| XLogP | 7.78 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |