C17H26O8 — CID 10594551
ethyl (2E,4E)-5-[(4aR,6S,7R,7aR)-7-hydroxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-yl]-4-(methoxymethoxy)penta-2,4-dienoate (PubChem CID 10594551) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[(4aR,6S,7R,7aR)-7-hydroxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-yl]-4-(methoxymethoxy)penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[(4aR,6S,7R,7aR)-7-hydroxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-yl]-4-(methoxymethoxy)penta-2,4-dienoate |
|---|---|
| PubChem CID | 10594551 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | ethyl (2E,4E)-5-[(4aR,6S,7R,7aR)-7-hydroxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-6-yl]-4-(methoxymethoxy)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(=C\[C@@H]1O[C@@H]2COC(C)(C)O[C@@H]2[C@@H]1O)OCOC |
| InChI | InChI=1S/C17H26O8/c1-5-21-14(18)7-6-11(22-10-20-4)8-12-15(19)16-13(24-12)9-23-17(2,3)25-16/h6-8,12-13,15-16,19H,5,9-10H2,1-4H3/b7-6+,11-8+/t12-,13+,15+,16-/m0/s1 |
| InChIKey | ZEHSHQHVVYSDBB-JUNJEEENSA-N |
| XLogP | 0.89 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|