C17H26O8 — CID 10832226
ethyl 2-[(1R,2S,7R,9S)-11-(methoxymethoxy)-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,7]tridec-10-en-12-yl]acetate (PubChem CID 10832226) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,7R,9S)-11-(methoxymethoxy)-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,7]tridec-10-en-12-yl]acetate.
| Compound Name | ethyl 2-[(1R,2S,7R,9S)-11-(methoxymethoxy)-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,7]tridec-10-en-12-yl]acetate |
|---|---|
| PubChem CID | 10832226 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | ethyl 2-[(1R,2S,7R,9S)-11-(methoxymethoxy)-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,7]tridec-10-en-12-yl]acetate |
| SMILES | CCOC(=O)CC1O[C@H]2[C@H]3OC(C)(C)OC[C@H]3O[C@H]2C=C1OCOC |
| InChI | InChI=1S/C17H26O8/c1-5-20-14(18)7-11-10(21-9-19-4)6-12-15(24-11)16-13(23-12)8-22-17(2,3)25-16/h6,11-13,15-16H,5,7-9H2,1-4H3/t11?,12-,13+,15+,16-/m0/s1 |
| InChIKey | ONCAQMZOHSGABD-DMOAEUIVSA-N |
| XLogP | 1.13 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|