C20H17ClFO2P — CID 10595603
(1S,2R)-1-(2-chlorophenyl)-2-diphenylphosphoryl-2-fluoroethanol (PubChem CID 10595603) has the molecular formula C20H17ClFO2P and a molecular weight of 374.78 g/mol. Its IUPAC name is (1S,2R)-1-(2-chlorophenyl)-2-diphenylphosphoryl-2-fluoroethanol.
| Compound Name | (1S,2R)-1-(2-chlorophenyl)-2-diphenylphosphoryl-2-fluoroethanol |
|---|---|
| PubChem CID | 10595603 |
| Molecular Formula | C20H17ClFO2P |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (1S,2R)-1-(2-chlorophenyl)-2-diphenylphosphoryl-2-fluoroethanol |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@@H](F)[C@@H](O)c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClFO2P/c21-18-14-8-7-13-17(18)19(23)20(22)25(24,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19-20,23H/t19-,20+/m0/s1 |
| InChIKey | JCNQGPFYYHLRQB-VQTJNVASSA-N |
| XLogP | 4.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|