C19H17FNO2P — CID 101097525
(1S,2S)-2-diphenylphosphoryl-2-fluoro-1-pyridin-2-ylethanol (PubChem CID 101097525) has the molecular formula C19H17FNO2P and a molecular weight of 341.32 g/mol. Its IUPAC name is (1S,2S)-2-diphenylphosphoryl-2-fluoro-1-pyridin-2-ylethanol.
| Compound Name | (1S,2S)-2-diphenylphosphoryl-2-fluoro-1-pyridin-2-ylethanol |
|---|---|
| PubChem CID | 101097525 |
| Molecular Formula | C19H17FNO2P |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (1S,2S)-2-diphenylphosphoryl-2-fluoro-1-pyridin-2-ylethanol |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@H](F)[C@@H](O)c1ccccn1 |
| InChI | InChI=1S/C19H17FNO2P/c20-19(18(22)17-13-7-8-14-21-17)24(23,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,18-19,22H/t18-,19-/m0/s1 |
| InChIKey | YSXAPEGYZFEYKU-OALUTQOASA-N |
| XLogP | 3.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|