C21H38O4Si — CID 10596098
(3R)-3-(2-phenylethyl)-3-(2-trimethylsilylethoxymethoxymethoxy)hexan-1-ol (PubChem CID 10596098) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is (3R)-3-(2-phenylethyl)-3-(2-trimethylsilylethoxymethoxymethoxy)hexan-1-ol.
| Compound Name | (3R)-3-(2-phenylethyl)-3-(2-trimethylsilylethoxymethoxymethoxy)hexan-1-ol |
|---|---|
| PubChem CID | 10596098 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (3R)-3-(2-phenylethyl)-3-(2-trimethylsilylethoxymethoxymethoxy)hexan-1-ol |
| SMILES | CCC[C@](CCO)(CCc1ccccc1)OCOCOCC[Si](C)(C)C |
| InChI | InChI=1S/C21H38O4Si/c1-5-12-21(14-15-22,13-11-20-9-7-6-8-10-20)25-19-24-18-23-16-17-26(2,3)4/h6-10,22H,5,11-19H2,1-4H3/t21-/m1/s1 |
| InChIKey | IPMNXCZEMADBLB-OAQYLSRUSA-N |
| XLogP | 4.84 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|