About methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate
methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate (PubChem CID 10620039) has the molecular formula C20H32O7
and a molecular weight of 384.47 g/mol. Its IUPAC name is methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate.
Molecular Properties
| Compound Name | methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate |
| PubChem CID | 10620039 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate |
| SMILES | CCC[C@@](CCc1ccccc1)(CC(=O)OCOCOC)OCOCOC |
| InChI | InChI=1S/C20H32O7/c1-4-11-20(27-17-25-15-23-3,12-10-18-8-6-5-7-9-18)13-19(21)26-16-24-14-22-2/h5-9H,4,10-17H2,1-3H3/t20-/m1/s1 |
| InChIKey | WYUATMSARNDGGG-HXUWFJFHSA-N |
| XLogP | 3.26 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate?
The IUPAC name of methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate (CID 10620039) is methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate.
What is the SMILES notation for methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate?
The canonical SMILES for methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate is CCC[C@@](CCc1ccccc1)(CC(=O)OCOCOC)OCOCOC.
What is the InChIKey of methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate?
The InChIKey is WYUATMSARNDGGG-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H32O7/c1-4-11-20(27-17-25-15-23-3,12-10-18-8-6-5-7-9-18)13-19(21)26-16-24-14-22-2/h5-9H,4,10-17H2,1-3H3/t20-/m1/s1.
What are the key properties of methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate?
methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate has a molecular weight of 384.47 g/mol, XLogP of 3.26, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethoxymethyl (3R)-3-(methoxymethoxymethoxy)-3-(2-phenylethyl)hexanoate is sourced from PubChem (CID 10620039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).