C25H26N2O3 — CID 10597245
benzyl (10S,11R,12R)-12-ethenyl-4-methoxy-8-methyl-8,13-diazatetracyclo[7.6.0.02,7.010,13]pentadeca-1(9),2(7),3,5-tetraene-11-carboxylate (PubChem CID 10597245) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is benzyl (10S,11R,12R)-12-ethenyl-4-methoxy-8-methyl-8,13-diazatetracyclo[7.6.0.02,7.010,13]pentadeca-1(9),2(7),3,5-tetraene-11-carboxylate.
| Compound Name | benzyl (10S,11R,12R)-12-ethenyl-4-methoxy-8-methyl-8,13-diazatetracyclo[7.6.0.02,7.010,13]pentadeca-1(9),2(7),3,5-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 10597245 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | benzyl (10S,11R,12R)-12-ethenyl-4-methoxy-8-methyl-8,13-diazatetracyclo[7.6.0.02,7.010,13]pentadeca-1(9),2(7),3,5-tetraene-11-carboxylate |
| SMILES | C=C[C@@H]1[C@@H](C(=O)OCc2ccccc2)[C@H]2c3c(c4cc(OC)ccc4n3C)CCN12 |
| InChI | InChI=1S/C25H26N2O3/c1-4-20-22(25(28)30-15-16-8-6-5-7-9-16)24-23-18(12-13-27(20)24)19-14-17(29-3)10-11-21(19)26(23)2/h4-11,14,20,22,24H,1,12-13,15H2,2-3H3/t20-,22-,24+/m1/s1 |
| InChIKey | SNEDQPKMYNHZLM-BKULYWANSA-N |
| XLogP | 4.01 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|