C26H38O3Si — CID 10598542
tert-butyl-[(3S)-3-methyl-4-(oxan-2-yloxy)butoxy]-diphenylsilane (PubChem CID 10598542) has the molecular formula C26H38O3Si and a molecular weight of 426.67 g/mol. Its IUPAC name is tert-butyl-[(3S)-3-methyl-4-(oxan-2-yloxy)butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3S)-3-methyl-4-(oxan-2-yloxy)butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10598542 |
| Molecular Formula | C26H38O3Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | tert-butyl-[(3S)-3-methyl-4-(oxan-2-yloxy)butoxy]-diphenylsilane |
| SMILES | C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)COC1CCCCO1 |
| InChI | InChI=1S/C26H38O3Si/c1-22(21-28-25-17-11-12-19-27-25)18-20-29-30(26(2,3)4,23-13-7-5-8-14-23)24-15-9-6-10-16-24/h5-10,13-16,22,25H,11-12,17-21H2,1-4H3/t22-,25?/m0/s1 |
| InChIKey | TZEMLJXDLQQIJR-XADRRFQNSA-N |
| XLogP | 5.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|