C29H36OS2Si — CID 10601216
dimethyl-(2-methylprop-2-enyl)-[5-phenyl-1,1-bis(phenylsulfanyl)pentan-3-yl]oxysilane (PubChem CID 10601216) has the molecular formula C29H36OS2Si and a molecular weight of 492.83 g/mol. Its IUPAC name is dimethyl-(2-methylprop-2-enyl)-[5-phenyl-1,1-bis(phenylsulfanyl)pentan-3-yl]oxysilane.
| Compound Name | dimethyl-(2-methylprop-2-enyl)-[5-phenyl-1,1-bis(phenylsulfanyl)pentan-3-yl]oxysilane |
|---|---|
| PubChem CID | 10601216 |
| Molecular Formula | C29H36OS2Si |
| Molecular Weight | 492.83 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | dimethyl-(2-methylprop-2-enyl)-[5-phenyl-1,1-bis(phenylsulfanyl)pentan-3-yl]oxysilane |
| SMILES | C=C(C)C[Si](C)(C)OC(CCc1ccccc1)CC(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C29H36OS2Si/c1-24(2)23-33(3,4)30-26(21-20-25-14-8-5-9-15-25)22-29(31-27-16-10-6-11-17-27)32-28-18-12-7-13-19-28/h5-19,26,29H,1,20-23H2,2-4H3 |
| InChIKey | HIDGLDZLMAWOJM-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.83 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|