C27H18Cl2N4S — CID 10601494
1,3-bis(4-chlorophenyl)-4-phenyl-4H-pyrido[2,1-b]purine-2-thione (PubChem CID 10601494) has the molecular formula C27H18Cl2N4S and a molecular weight of 501.44 g/mol. Its IUPAC name is 1,3-bis(4-chlorophenyl)-4-phenyl-4H-pyrido[2,1-b]purine-2-thione.
| Compound Name | 1,3-bis(4-chlorophenyl)-4-phenyl-4H-pyrido[2,1-b]purine-2-thione |
|---|---|
| PubChem CID | 10601494 |
| Molecular Formula | C27H18Cl2N4S |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 1,3-bis(4-chlorophenyl)-4-phenyl-4H-pyrido[2,1-b]purine-2-thione |
| SMILES | S=c1n(-c2ccc(Cl)cc2)c2c(n1-c1ccc(Cl)cc1)N1C=CC=CC1=NC2c1ccccc1 |
| InChI | InChI=1S/C27H18Cl2N4S/c28-19-9-13-21(14-10-19)32-25-24(18-6-2-1-3-7-18)30-23-8-4-5-17-31(23)26(25)33(27(32)34)22-15-11-20(29)12-16-22/h1-17,24H |
| InChIKey | FWKZACJGPTXZFU-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 25.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|