C29H23FN4S — CID 10767026
4-(4-fluorophenyl)-1,3-bis(4-methylphenyl)-4H-pyrido[2,1-b]purine-2-thione (PubChem CID 10767026) has the molecular formula C29H23FN4S and a molecular weight of 478.60 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,3-bis(4-methylphenyl)-4H-pyrido[2,1-b]purine-2-thione.
| Compound Name | 4-(4-fluorophenyl)-1,3-bis(4-methylphenyl)-4H-pyrido[2,1-b]purine-2-thione |
|---|---|
| PubChem CID | 10767026 |
| Molecular Formula | C29H23FN4S |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 4-(4-fluorophenyl)-1,3-bis(4-methylphenyl)-4H-pyrido[2,1-b]purine-2-thione |
| SMILES | Cc1ccc(-n2c3c(n(-c4ccc(C)cc4)c2=S)N2C=CC=CC2=NC3c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H23FN4S/c1-19-6-14-23(15-7-19)33-27-26(21-10-12-22(30)13-11-21)31-25-5-3-4-18-32(25)28(27)34(29(33)35)24-16-8-20(2)9-17-24/h3-18,26H,1-2H3 |
| InChIKey | BVPHYKVHWNOFCI-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 25.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|