C19H15N3S — CID 12867037
3,4-diphenyl-4H-pyrido[1,2-a][1,3,5]triazine-2-thione (PubChem CID 12867037) has the molecular formula C19H15N3S and a molecular weight of 317.42 g/mol. Its IUPAC name is 3,4-diphenyl-4H-pyrido[1,2-a][1,3,5]triazine-2-thione.
| Compound Name | 3,4-diphenyl-4H-pyrido[1,2-a][1,3,5]triazine-2-thione |
|---|---|
| PubChem CID | 12867037 |
| Molecular Formula | C19H15N3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 3,4-diphenyl-4H-pyrido[1,2-a][1,3,5]triazine-2-thione |
| SMILES | S=C1N=C2C=CC=CN2C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C19H15N3S/c23-19-20-17-13-7-8-14-21(17)18(15-9-3-1-4-10-15)22(19)16-11-5-2-6-12-16/h1-14,18H |
| InChIKey | KHRPGKVBDNXDKE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|