C15H15N5 — CID 692136
(2S)-1,2-diphenyl-2H-1,3,5-triazine-4,6-diamine (PubChem CID 692136) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is (2S)-1,2-diphenyl-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | (2S)-1,2-diphenyl-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 692136 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2S)-1,2-diphenyl-2H-1,3,5-triazine-4,6-diamine |
| SMILES | NC1=N[C@H](c2ccccc2)N(c2ccccc2)C(N)=N1 |
| InChI | InChI=1S/C15H15N5/c16-14-18-13(11-7-3-1-4-8-11)20(15(17)19-14)12-9-5-2-6-10-12/h1-10,13H,(H4,16,17,18,19)/t13-/m0/s1 |
| InChIKey | GWOLNTNSXCWRKK-ZDUSSCGKSA-N |
| XLogP | 1.83 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |