C27H19FN4S — CID 10837269
4-(4-fluorophenyl)-1,3-diphenyl-4H-pyrido[2,1-b]purine-2-thione (PubChem CID 10837269) has the molecular formula C27H19FN4S and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,3-diphenyl-4H-pyrido[2,1-b]purine-2-thione.
| Compound Name | 4-(4-fluorophenyl)-1,3-diphenyl-4H-pyrido[2,1-b]purine-2-thione |
|---|---|
| PubChem CID | 10837269 |
| Molecular Formula | C27H19FN4S |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 4-(4-fluorophenyl)-1,3-diphenyl-4H-pyrido[2,1-b]purine-2-thione |
| SMILES | Fc1ccc(C2N=C3C=CC=CN3c3c2n(-c2ccccc2)c(=S)n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H19FN4S/c28-20-16-14-19(15-17-20)24-25-26(30-18-8-7-13-23(30)29-24)32(22-11-5-2-6-12-22)27(33)31(25)21-9-3-1-4-10-21/h1-18,24H |
| InChIKey | WJZPOPOZMDMLJZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 25.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|