About 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone
1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone (PubChem CID 10602113) has the molecular formula C30H42O4Si2
and a molecular weight of 522.83 g/mol. Its IUPAC name is 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone |
| PubChem CID | 10602113 |
| Molecular Formula | C30H42O4Si2 |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c3ccc(C(C)=O)cc3c2c1 |
| InChI | InChI=1S/C30H42O4Si2/c1-19(31)21-13-15-23-25(17-21)26-18-22(20(2)32)14-16-24(26)28(34-36(11,12)30(6,7)8)27(23)33-35(9,10)29(3,4)5/h13-18H,1-12H3 |
| InChIKey | JJEYMLAYTDJUSF-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone?
The IUPAC name of 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone (CID 10602113) is 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone.
What is the SMILES notation for 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone?
The canonical SMILES for 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone is CC(=O)c1ccc2c(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c3ccc(C(C)=O)cc3c2c1.
What is the InChIKey of 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone?
The InChIKey is JJEYMLAYTDJUSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H42O4Si2/c1-19(31)21-13-15-23-25(17-21)26-18-22(20(2)32)14-16-24(26)28(34-36(11,12)30(6,7)8)27(23)33-35(9,10)29(3,4)5/h13-18H,1-12H3.
What are the key properties of 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone?
1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone has a molecular weight of 522.83 g/mol, XLogP of 9.17, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone is sourced from PubChem (CID 10602113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).