C30H42O4Si2 — CID 10602113
1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone (PubChem CID 10602113) has the molecular formula C30H42O4Si2 and a molecular weight of 522.83 g/mol. Its IUPAC name is 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone.
| Compound Name | 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone |
|---|---|
| PubChem CID | 10602113 |
| Molecular Formula | C30H42O4Si2 |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 1-[6-acetyl-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]phenanthren-3-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c3ccc(C(C)=O)cc3c2c1 |
| InChI | InChI=1S/C30H42O4Si2/c1-19(31)21-13-15-23-25(17-21)26-18-22(20(2)32)14-16-24(26)28(34-36(11,12)30(6,7)8)27(23)33-35(9,10)29(3,4)5/h13-18H,1-12H3 |
| InChIKey | JJEYMLAYTDJUSF-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|