C28H29NO3SSe — CID 10602487
N-[(1R)-1-(furan-2-yl)-3-phenylpropyl]-4-methyl-N-(2-phenylselanylethyl)benzenesulfonamide (PubChem CID 10602487) has the molecular formula C28H29NO3SSe and a molecular weight of 538.57 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)-3-phenylpropyl]-4-methyl-N-(2-phenylselanylethyl)benzenesulfonamide.
| Compound Name | N-[(1R)-1-(furan-2-yl)-3-phenylpropyl]-4-methyl-N-(2-phenylselanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 10602487 |
| Molecular Formula | C28H29NO3SSe |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)-3-phenylpropyl]-4-methyl-N-(2-phenylselanylethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC[Se]c2ccccc2)[C@H](CCc2ccccc2)c2ccco2)cc1 |
| InChI | InChI=1S/C28H29NO3SSe/c1-23-14-17-25(18-15-23)33(30,31)29(20-22-34-26-11-6-3-7-12-26)27(28-13-8-21-32-28)19-16-24-9-4-2-5-10-24/h2-15,17-18,21,27H,16,19-20,22H2,1H3/t27-/m1/s1 |
| InChIKey | KHQWTVSVHOJSMM-HHHXNRCGSA-N |
| XLogP | 5.40 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|