C29H31NO7S2 — CID 10840784
2-[[(1R)-1-(furan-2-yl)-2-phenylmethoxyethyl]-(4-methylphenyl)sulfonylamino]ethyl 4-methylbenzenesulfonate (PubChem CID 10840784) has the molecular formula C29H31NO7S2 and a molecular weight of 569.70 g/mol. Its IUPAC name is 2-[[(1R)-1-(furan-2-yl)-2-phenylmethoxyethyl]-(4-methylphenyl)sulfonylamino]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[[(1R)-1-(furan-2-yl)-2-phenylmethoxyethyl]-(4-methylphenyl)sulfonylamino]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10840784 |
| Molecular Formula | C29H31NO7S2 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | 2-[[(1R)-1-(furan-2-yl)-2-phenylmethoxyethyl]-(4-methylphenyl)sulfonylamino]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCN([C@H](COCc2ccccc2)c2ccco2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H31NO7S2/c1-23-10-14-26(15-11-23)38(31,32)30(18-20-37-39(33,34)27-16-12-24(2)13-17-27)28(29-9-6-19-36-29)22-35-21-25-7-4-3-5-8-25/h3-17,19,28H,18,20-22H2,1-2H3/t28-/m1/s1 |
| InChIKey | UJNOEPZWVQUZAL-MUUNZHRXSA-N |
| XLogP | 5.25 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|