C32H39NO6Si — CID 10602974
methyl 2-[(3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-3-(phenylmethoxymethoxy)pyrrolidin-1-yl]acetate (PubChem CID 10602974) has the molecular formula C32H39NO6Si and a molecular weight of 561.75 g/mol. Its IUPAC name is methyl 2-[(3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-3-(phenylmethoxymethoxy)pyrrolidin-1-yl]acetate.
| Compound Name | methyl 2-[(3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-3-(phenylmethoxymethoxy)pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 10602974 |
| Molecular Formula | C32H39NO6Si |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | methyl 2-[(3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxo-3-(phenylmethoxymethoxy)pyrrolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)[C@@H](OCOCc2ccccc2)C[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H39NO6Si/c1-32(2,3)40(27-16-10-6-11-17-27,28-18-12-7-13-19-28)39-23-26-20-29(31(35)33(26)21-30(34)36-4)38-24-37-22-25-14-8-5-9-15-25/h5-19,26,29H,20-24H2,1-4H3/t26-,29+/m1/s1 |
| InChIKey | RJOVGLQQCDTMOK-UHSQPCAPSA-N |
| XLogP | 3.90 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|