C9H18N4O2S — CID 106066562
N-[2-(1H-imidazol-5-yl)ethyl]-1-(methylamino)propane-2-sulfonamide (PubChem CID 106066562) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-1-(methylamino)propane-2-sulfonamide.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-1-(methylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106066562 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-1-(methylamino)propane-2-sulfonamide |
| SMILES | CNCC(C)S(=O)(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C9H18N4O2S/c1-8(5-10-2)16(14,15)13-4-3-9-6-11-7-12-9/h6-8,10,13H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | SEAKXYKEGVOPDS-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |