C14H24O2 — CID 10609204
(3E,5E,7E)-tetradeca-3,5,7-triene-2,9-diol (PubChem CID 10609204) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (3E,5E,7E)-tetradeca-3,5,7-triene-2,9-diol.
| Compound Name | (3E,5E,7E)-tetradeca-3,5,7-triene-2,9-diol |
|---|---|
| PubChem CID | 10609204 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (3E,5E,7E)-tetradeca-3,5,7-triene-2,9-diol |
| SMILES | CCCCCC(O)/C=C/C=C/C=C/C(C)O |
| InChI | InChI=1S/C14H24O2/c1-3-4-7-11-14(16)12-9-6-5-8-10-13(2)15/h5-6,8-10,12-16H,3-4,7,11H2,1-2H3/b6-5+,10-8+,12-9+ |
| InChIKey | COKRUONGONTKGV-MVZORFNWSA-N |
| XLogP | 2.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|