C9H13NO5 — CID 106108334
2-methoxy-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoic acid (PubChem CID 106108334) has the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. Its IUPAC name is 2-methoxy-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoic acid.
| Compound Name | 2-methoxy-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 106108334 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-methoxy-3-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanoic acid |
| SMILES | COC(CN1C(=O)CC(C)C1=O)C(=O)O |
| InChI | InChI=1S/C9H13NO5/c1-5-3-7(11)10(8(5)12)4-6(15-2)9(13)14/h5-6H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | VNLPPEDASQVFIF-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|