C12H15N3O3S — CID 106111669
3-amino-2-methoxy-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide (PubChem CID 106111669) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide.
| Compound Name | 3-amino-2-methoxy-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
|---|---|
| PubChem CID | 106111669 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-amino-2-methoxy-N-(3-oxo-4H-1,4-benzothiazin-6-yl)propanamide |
| SMILES | COC(CN)C(=O)Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C12H15N3O3S/c1-18-9(5-13)12(17)14-7-2-3-10-8(4-7)15-11(16)6-19-10/h2-4,9H,5-6,13H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | UBQDSLNVBZYEBQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |