C7H11N5O2 — CID 106113956
3-amino-2-methoxy-N-(1,2,4-triazin-3-yl)propanamide (PubChem CID 106113956) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-(1,2,4-triazin-3-yl)propanamide.
| Compound Name | 3-amino-2-methoxy-N-(1,2,4-triazin-3-yl)propanamide |
|---|---|
| PubChem CID | 106113956 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 3-amino-2-methoxy-N-(1,2,4-triazin-3-yl)propanamide |
| SMILES | COC(CN)C(=O)Nc1nccnn1 |
| InChI | InChI=1S/C7H11N5O2/c1-14-5(4-8)6(13)11-7-9-2-3-10-12-7/h2-3,5H,4,8H2,1H3,(H,9,11,12,13) |
| InChIKey | JSZUBUQHDJBUIV-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |