About (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium
(E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium (PubChem CID 10612621) has the molecular formula C17H15N2O2+
and a molecular weight of 279.32 g/mol. Its IUPAC name is (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium.
Molecular Properties
| Compound Name | (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium |
| PubChem CID | 10612621 |
| Molecular Formula | C17H15N2O2+ |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium |
| SMILES | N#[N+]/C(CCC(=O)c1ccccc1)=C(/O)c1ccccc1 |
| InChI | InChI=1S/C17H14N2O2/c18-19-15(17(21)14-9-5-2-6-10-14)11-12-16(20)13-7-3-1-4-8-13/h1-10H,11-12H2/p+1/b17-15+ |
| InChIKey | FQDQLPSTOWDJPR-BMRADRMJSA-O |
| XLogP | 4.43 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium?
The IUPAC name of (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium (CID 10612621) is (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium.
What is the SMILES notation for (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium?
The canonical SMILES for (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium is N#[N+]/C(CCC(=O)c1ccccc1)=C(/O)c1ccccc1.
What is the InChIKey of (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium?
The InChIKey is FQDQLPSTOWDJPR-BMRADRMJSA-O. The full InChI is InChI=1S/C17H14N2O2/c18-19-15(17(21)14-9-5-2-6-10-14)11-12-16(20)13-7-3-1-4-8-13/h1-10H,11-12H2/p+1/b17-15+.
What are the key properties of (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium?
(E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium has a molecular weight of 279.32 g/mol, XLogP of 4.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-hydroxy-5-oxo-1,5-diphenylpent-1-ene-2-diazonium is sourced from PubChem (CID 10612621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).