C15H7N7 — CID 10613115
13-amino-8,12,16,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,10,12,14-octaene-14,15-dicarbonitrile (PubChem CID 10613115) has the molecular formula C15H7N7 and a molecular weight of 285.27 g/mol. Its IUPAC name is 13-amino-8,12,16,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,10,12,14-octaene-14,15-dicarbonitrile.
| Compound Name | 13-amino-8,12,16,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,10,12,14-octaene-14,15-dicarbonitrile |
|---|---|
| PubChem CID | 10613115 |
| Molecular Formula | C15H7N7 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 13-amino-8,12,16,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,10,12,14-octaene-14,15-dicarbonitrile |
| SMILES | N#Cc1c(N)nc2c3cnc4ccccc4c3nn2c1C#N |
| InChI | InChI=1S/C15H7N7/c16-5-9-12(6-17)22-15(20-14(9)18)10-7-19-11-4-2-1-3-8(11)13(10)21-22/h1-4,7H,(H2,18,20) |
| InChIKey | AKNMSMBAWVPZDF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |