C11H19NO — CID 106131669
3-(2,5-dihydropyrrol-1-ylmethyl)cyclohexan-1-ol (PubChem CID 106131669) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-(2,5-dihydropyrrol-1-ylmethyl)cyclohexan-1-ol.
| Compound Name | 3-(2,5-dihydropyrrol-1-ylmethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 106131669 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-(2,5-dihydropyrrol-1-ylmethyl)cyclohexan-1-ol |
| SMILES | OC1CCCC(CN2CC=CC2)C1 |
| InChI | InChI=1S/C11H19NO/c13-11-5-3-4-10(8-11)9-12-6-1-2-7-12/h1-2,10-11,13H,3-9H2 |
| InChIKey | FDBNWRALFDBQHW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|