C9H17N2O+ — CID 10613832
(5S,7R)-1-methyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-ol (PubChem CID 10613832) has the molecular formula C9H17N2O+ and a molecular weight of 169.25 g/mol. Its IUPAC name is (5S,7R)-1-methyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-ol.
| Compound Name | (5S,7R)-1-methyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-ol |
|---|---|
| PubChem CID | 10613832 |
| Molecular Formula | C9H17N2O+ |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (5S,7R)-1-methyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-ol |
| SMILES | C[N+]12C[C@H]3CN(C[C@@H](C1)C3O)C2 |
| InChI | InChI=1S/C9H17N2O/c1-11-4-7-2-10(6-11)3-8(5-11)9(7)12/h7-9,12H,2-6H2,1H3/q+1/t7-,8+,9?,11? |
| InChIKey | VWSFWCBSXVEAHM-REMFIFCHSA-N |
| XLogP | -0.67 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|