C14H30N4+2 — CID 10577560
1,8-dimethyl-4,11-diaza-1,8-diazoniatricyclo[9.3.1.14,8]hexadecane (PubChem CID 10577560) has the molecular formula C14H30N4+2 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1,8-dimethyl-4,11-diaza-1,8-diazoniatricyclo[9.3.1.14,8]hexadecane.
| Compound Name | 1,8-dimethyl-4,11-diaza-1,8-diazoniatricyclo[9.3.1.14,8]hexadecane |
|---|---|
| PubChem CID | 10577560 |
| Molecular Formula | C14H30N4+2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | 1,8-dimethyl-4,11-diaza-1,8-diazoniatricyclo[9.3.1.14,8]hexadecane |
| SMILES | C[N+]12CCCN(CC[N+]3(C)CCCN(CC1)C3)C2 |
| InChI | InChI=1S/C14H30N4/c1-17-9-3-5-15(13-17)8-12-18(2)10-4-6-16(14-18)7-11-17/h3-14H2,1-2H3/q+2 |
| InChIKey | ZMXFTCCFPFIOPW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|